Systematic / IUPAC Name: N-[4-[(2R,3R)-4-(2-Aminoethyl)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-4-methoxybenzamide
ID: Reference10145
Other Names:
Benzamide, N-[4-[(2R,3R)-4-(2-aminoethyl)-3-(hydroxymethyl)-5-oxo-2-morpholinyl]phenyl]-4-methoxy-;
NAT36-531494
Formula: C21H25N3O5
N-{4-[(2R,3R)-4-(2-Aminoethyl)-3-(hydroxymethyl)-5-oxo-2-morpholinyl]phenyl}-4-methoxybenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2145 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/11/2020 11:17:25 AM |
| InChI | InChI=1S/C21H25N3O5/c1-28-17-8-4-15(5-9-17)21(27)23-16-6-2-14(3-7-16)20-18(12-25)24(11-10-22)19(26)13-29-20/h2-9,18,20,25H,10-13,22H2,1H3,(H,23,27)/t18-,20-/m1/s1 |
| InChI Key | BUNNAAYJGRQUCK-UYAOXDASSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)C3C(N(C(=O)CO3)CCN)CO |
| CAS | |
| Splash | |
| Other Names |
Benzamide, N-[4-[(2R,3R)-4-(2-aminoethyl)-3-(hydroxymethyl)-5-oxo-2-morpholinyl]phenyl]-4-methoxy-; NAT36-531494 |