Systematic / IUPAC Name: 2-[3-[[3-(Oxan-4-ylamino)oxetan-3-yl]methyl]-1,2-oxazol-5-yl]ethanol
ID: Reference10173
Other Names:
5-Isoxazoleethanol, 3-[[3-[(tetrahydro-2H-pyran-4-yl)amino]-3-oxetanyl]methyl]-;
NAT39-499958
Formula: C14H22N2O4
2-(3-{[3-(Tetrahydro-2H-pyran-4-ylamino)-3-oxetanyl]methyl}-1,2-oxazol-5-yl)ethanol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 901 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/15/2021 1:57:43 PM |
| InChI | InChI=1S/C14H22N2O4/c17-4-1-13-7-12(16-20-13)8-14(9-19-10-14)15-11-2-5-18-6-3-11/h7,11,15,17H,1-6,8-10H2 |
| InChI Key | OZWXUODGHUWUPY-UHFFFAOYSA-N |
| Canonical SMILES | C1COCCC1NC2(COC2)CC3=NOC(=C3)CCO |
| CAS | |
| Splash | |
| Other Names |
5-Isoxazoleethanol, 3-[[3-[(tetrahydro-2H-pyran-4-yl)amino]-3-oxetanyl]methyl]-; NAT39-499958 |