Systematic / IUPAC Name: 4-[2-[[1-Amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]carbamoyl]-4-[(2-methylsulfanylacetyl)amino]piperidin-1-yl]-4-oxobutanoic acid
ID: Reference10217
Other Names:
1-Piperidinebutanoic acid, 2-[[[2-amino-1-[(4-methoxyphenyl)methyl]-2-oxoethyl]amino]carbonyl]-4-[[2-(methylthio)acetyl]amino]-γ-oxo-;
NAT7-255909
Formula: C23H32N4O7S
4-(2-{[1-Amino-3-(4-methoxyphenyl)-1-oxo-2-propanyl]carbamoyl}-4-{[(methylsulfanyl)acetyl]amino}-1-piperidinyl)-4-oxobutanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3591 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/29/2021 2:52:03 PM |
| InChI | InChI=1S/C23H32N4O7S/c1-34-16-5-3-14(4-6-16)11-17(22(24)32)26-23(33)18-12-15(25-19(28)13-35-2)9-10-27(18)20(29)7-8-21(30)31/h3-6,15,17-18H,7-13H2,1-2H3,(H2,24,32)(H,25,28)(H,26,33)(H,30,31) |
| InChI Key | HBHCRDVSXOVLGJ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)CC(C(=O)N)NC(=O)C2CC(CCN2C(=O)CCC(=O)O)NC(=O)CSC |
| CAS | |
| Splash | |
| Other Names |
1-Piperidinebutanoic acid, 2-[[[2-amino-1-[(4-methoxyphenyl)methyl]-2-oxoethyl]amino]carbonyl]-4-[[2-(methylthio)acetyl]amino]-γ-oxo-; NAT7-255909 |