Systematic / IUPAC Name: N-[4-[(2R,3R)-3-(Hydroxymethyl)-5-oxo-4-propan-2-ylmorpholin-2-yl]phenyl]pyrazine-2-carboxamide
ID: Reference10221
Other Names:
2-Pyrazinecarboxamide, N-[4-[(2R,3R)-3-(hydroxymethyl)-4-(1-methylethyl)-5-oxo-2-morpholinyl]phenyl]-;
NAT36-531124
Formula: C19H22N4O4
N-{4-[(2R,3R)-3-(Hydroxymethyl)-4-isopropyl-5-oxo-2-morpholinyl]phenyl}-2-pyrazinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3275 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/5/2021 1:27:06 PM |
| InChI | InChI=1S/C19H22N4O4/c1-12(2)23-16(10-24)18(27-11-17(23)25)13-3-5-14(6-4-13)22-19(26)15-9-20-7-8-21-15/h3-9,12,16,18,24H,10-11H2,1-2H3,(H,22,26)/t16-,18-/m1/s1 |
| InChI Key | CJGPBGKILFVHAE-SJLPKXTDSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
2-Pyrazinecarboxamide, N-[4-[(2R,3R)-3-(hydroxymethyl)-4-(1-methylethyl)-5-oxo-2-morpholinyl]phenyl]-; NAT36-531124 |