Systematic / IUPAC Name: 1-[4-[(2R,3R)-3-(Hydroxymethyl)-4-(oxan-4-yl)-5-oxomorpholin-2-yl]phenyl]-3-propan-2-ylurea
ID: Reference10235
Other Names:
Urea, N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxo-4-(tetrahydro-2H-pyran-4-yl)-2-morpholinyl]phenyl]-N'-(1-methylethyl)-;
NAT36-531795
Formula: C20H29N3O5
1-{4-[(2R,3R)-3-(Hydroxymethyl)-5-oxo-4-(tetrahydro-2H-pyran-4-yl)-2-morpholinyl]phenyl}-3-isopropylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3042 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/12/2021 2:27:19 PM |
| InChI | InChI=1S/C20H29N3O5/c1-13(2)21-20(26)22-15-5-3-14(4-6-15)19-17(11-24)23(18(25)12-28-19)16-7-9-27-10-8-16/h3-6,13,16-17,19,24H,7-12H2,1-2H3,(H2,21,22,26)/t17-,19-/m1/s1 |
| InChI Key | DEFZJYIWNGYDKM-IEBWSBKVSA-N |
| Canonical SMILES | CC(C)NC(=O)NC1=CC=C(C=C1)C2C(N(C(=O)CO2)C3CCOCC3)CO |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxo-4-(tetrahydro-2H-pyran-4-yl)-2-morpholinyl]phenyl]-N'-(1-methylethyl)-; NAT36-531795 |