Systematic / IUPAC Name: 4-Cyano-N-[4-[(2R,3R)-3-(hydroxymethyl)-4-(oxan-4-yl)-5-oxomorpholin-2-yl]phenyl]benzamide
ID: Reference10242
Other Names:
Benzamide, 4-cyano-N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxo-4-(tetrahydro-2H-pyran-4-yl)-2-morpholinyl]phenyl]-;
NAT36-531783
Formula: C24H25N3O5
4-Cyano-N-{4-[(2R,3R)-3-(hydroxymethyl)-5-oxo-4-(tetrahydro-2H-pyran-4-yl)-2-morpholinyl]phenyl}benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2714 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/18/2021 11:58:29 AM |
| InChI | InChI=1S/C24H25N3O5/c25-13-16-1-3-18(4-2-16)24(30)26-19-7-5-17(6-8-19)23-21(14-28)27(22(29)15-32-23)20-9-11-31-12-10-20/h1-8,20-21,23,28H,9-12,14-15H2,(H,26,30)/t21-,23-/m1/s1 |
| InChI Key | NUHUOEVJJGQQCS-FYYLOGMGSA-N |
| Canonical SMILES | C1COCCC1N2C(C(OCC2=O)C3=CC=C(C=C3)NC(=O)C4=CC=C(C=C4)C#N)CO |
| CAS | |
| Splash | |
| Other Names |
Benzamide, 4-cyano-N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxo-4-(tetrahydro-2H-pyran-4-yl)-2-morpholinyl]phenyl]-; NAT36-531783 |