Systematic / IUPAC Name: Diethyl 2-isopropyl-6-methyl-4-pyrimidinyl phosphate
ID: Reference1025
Other Names:
Phosphoric acid, diethyl 6-methyl-2-(1-methylethyl)-4-pyrimidinyl ester;
Diethyl 2-isopropyl-6-methylpyrimidin-4-yl phosphate;
Diethyl 6-methyl-2-(1-methylethyl)-4-pyrimidinyl phosphate;
O,O-Diethyl O-(2-isopropyl-4-methylpyrimid-6-yl)phosphate;
Diethyl (6-methyl-2-propan-2-ylpyrimidin-4-yl) phosphate
Formula: C12H21N2O4P
Class: Pesticides/Herbicides
Diazoxon mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1974 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 8/11/2014 9:42:46 AM |
| InChI | InChI=1S/C12H21N2O4P/c1-6-16-19(15,17-7-2)18-11-8-10(5)13-12(14-11)9(3)4/h8-9H,6-7H2,1-5H3 |
| InChI Key | VBLJFQYCTRKKKF-UHFFFAOYSA-N |
| Canonical SMILES | CCOP(=O)(OCC)OC1=NC(=NC(=C1)C)C(C)C |
| CAS | 962583 |
| Splash | |
| Other Names |
Phosphoric acid, diethyl 6-methyl-2-(1-methylethyl)-4-pyrimidinyl ester; Diethyl 2-isopropyl-6-methylpyrimidin-4-yl phosphate; Diethyl 6-methyl-2-(1-methylethyl)-4-pyrimidinyl phosphate; O,O-Diethyl O-(2-isopropyl-4-methylpyrimid-6-yl)phosphate; Diethyl (6-methyl-2-propan-2-ylpyrimidin-4-yl) phosphate |
| ChemSpider | 13157 |
| ChEMBL | CHEMBL1901616 |
| ChemIDPlus | 000962583 |
| PubChem | 13754 |