Systematic / IUPAC Name: 2-[2-[[(3S,5S)-5-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-methylpyrrolidin-3-yl]amino]-2-oxoethoxy]acetic acid
ID: Reference10275
Other Names:
Acetic acid, 2-[2-[[(3S,5S)-5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-methyl-3-pyrrolidinyl]amino]-2-oxoethoxy]-;
NAT18-356380
Formula: C18H22N4O6
[2-({(3S,5S)-5-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-methyl-3-pyrrolidinyl}amino)-2-oxoethoxy]acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1499 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/5/2021 2:34:30 PM |
| InChI | InChI=1S/C18H22N4O6/c1-22-8-12(19-15(23)9-27-10-16(24)25)7-14(22)18-20-17(21-28-18)11-3-5-13(26-2)6-4-11/h3-6,12,14H,7-10H2,1-2H3,(H,19,23)(H,24,25)/t12-,14-/m0/s1 |
| InChI Key | FGCKGVIAHNIDSA-JSGCOSHPSA-N |
| Canonical SMILES | CN1CC(CC1C2=NC(=NO2)C3=CC=C(C=C3)OC)NC(=O)COCC(=O)O |
| CAS | |
| Splash | |
| Other Names |
Acetic acid, 2-[2-[[(3S,5S)-5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1-methyl-3-pyrrolidinyl]amino]-2-oxoethoxy]-; NAT18-356380 |