Systematic / IUPAC Name: N-[4-[(2R,3R)-3-(Hydroxymethyl)-4-(2-methylpropyl)-5-oxomorpholin-2-yl]phenyl]-2-methoxyacetamide
ID: Reference10288
Other Names:
Acetamide, N-[4-[(2R,3R)-3-(hydroxymethyl)-4-(2-methylpropyl)-5-oxo-2-morpholinyl]phenyl]-2-methoxy-;
NAT36-531040
Formula: C18H26N2O5
N-{4-[(2R,3R)-3-(Hydroxymethyl)-4-isobutyl-5-oxo-2-morpholinyl]phenyl}-2-methoxyacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1580 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/12/2021 10:44:04 AM |
| InChI | InChI=1S/C18H26N2O5/c1-12(2)8-20-15(9-21)18(25-11-17(20)23)13-4-6-14(7-5-13)19-16(22)10-24-3/h4-7,12,15,18,21H,8-11H2,1-3H3,(H,19,22)/t15-,18-/m1/s1 |
| InChI Key | HWIHAHBRQGXSLC-CRAIPNDOSA-N |
| Canonical SMILES | CC(C)CN1C(C(OCC1=O)C2=CC=C(C=C2)NC(=O)COC)CO |
| CAS | |
| Splash | |
| Other Names |
Acetamide, N-[4-[(2R,3R)-3-(hydroxymethyl)-4-(2-methylpropyl)-5-oxo-2-morpholinyl]phenyl]-2-methoxy-; NAT36-531040 |