Systematic / IUPAC Name: 2-[(1S,4S,5S)-4-(Benzenesulfonamidomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-(2-morpholin-4-ylethyl)acetamide
ID: Reference10339
Other Names: NAT28-402198
Formula: C25H39N3O4S
2-[(1S,4S,5S)-5-Isopropyl-2-methyl-4-{[(phenylsulfonyl)amino]methyl}-2-cyclohexen-1-yl]-N-[2-(4-morpholinyl)ethyl]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3940 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/31/2021 9:12:07 AM |
| InChI | InChI=1S/C25H39N3O4S/c1-19(2)24-16-21(17-25(29)26-9-10-28-11-13-32-14-12-28)20(3)15-22(24)18-27-33(30,31)23-7-5-4-6-8-23/h4-8,15,19,21-22,24,27H,9-14,16-18H2,1-3H3,(H,26,29)/t21-,22-,24-/m0/s1 |
| InChI Key | NLWPNVZRCUPTNL-FIXSFTCYSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NCCN2CCOCC2)C(C)C)CNS(=O)(=O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT28-402198 |