Systematic / IUPAC Name: Propan-2-yl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate
ID: Reference1035
Other Names:
Ankebin;
Antara;
Apo fenofibrate;
Controlip;
Durafenat
; more
Formula: C20H21ClO4
Class: Therapeutics/Prescription Drugs
Fenofibrate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 98 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/14/2016 11:54:36 AM |
| InChI | InChI=1S/C20H21ClO4/c1-13(2)24-19(23)20(3,4)25-17-11-7-15(8-12-17)18(22)14-5-9-16(21)10-6-14/h5-13H,1-4H3 |
| InChI Key | YMTINGFKWWXKFG-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)OC(=O)C(C)(C)OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Cl |
| CAS | 49562289 |
| Splash | |
| Other Names |
Ankebin; Antara; Apo fenofibrate; Controlip; Durafenat; Elasterate; Elasterin; Fenobeta; Fenobrate; Fenofanton; Fenogal; Fenoglide; Fenotard; Fibricor; Finofibrate; Fulcro; Gen fenofibrate; Lipanthyl; Lipantil; Liparison; Lipidex; Lipidil micro; Lipidil supra; Lipidil; Lipifen; Lipirex; Lipoclar; Lipofen; Lipofene; Liposit; Lipsin; Lofibra; Luxacor; M-Fenofibrate; Nolipax; Pharmavit; Phenofibrate; Procetofen; Procetofene; Proctofene; Protolipan; Secalip; Sedufen; Supralip; Tricor; Triglide; 2-[4-(4-Chlorobenzoyl)phenoxy]-2-methylpropanoic acid isopropyl ester; Isopropyl 2-[p-(p-chlorobenzoyl)phenoxy]-2-methylpropionate ; Isopropyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate; Methylethyl 2-{4-[(4-chlorophenyl)carbonyl]phenoxy}-2-methylpropanoate; Propanoic acid, 2-[4-(4-chlorobenzoyl)phenoxy]-2-methyl-, 1-methylethyl ester |
| ChemSpider | 3222 |
| ChEBI | CHEBI:5001 |
| KEGG | C07586; D00565 |
| HMDb | HMDB15173 |
| PubChem | 3339 |
| Wikipedia | Fenofibrate |
| DrugBank | APRD00405 |
| ChEMBL | CHEMBL672 |
| ChemIDPlus | 049562289 |