Systematic / IUPAC Name: 4-[[(3S)-3-[5-(2-Methoxyphenyl)-1,3,4-oxadiazol-2-yl]pyrrolidin-1-yl]methyl]benzoic acid
ID: Reference10364
Other Names:
Benzoic acid, 4-[[(3S)-3-[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-1-pyrrolidinyl]methyl]-;
NAT31-459568
Formula: C21H21N3O4
4-({(3S)-3-[5-(2-Methoxyphenyl)-1,3,4-oxadiazol-2-yl]-1-pyrrolidinyl}methyl)benzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1066 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/9/2021 1:52:26 PM |
| InChI | InChI=1S/C21H21N3O4/c1-27-18-5-3-2-4-17(18)20-23-22-19(28-20)16-10-11-24(13-16)12-14-6-8-15(9-7-14)21(25)26/h2-9,16H,10-13H2,1H3,(H,25,26)/t16-/m0/s1 |
| InChI Key | FMLJLNNNINBPFN-INIZCTEOSA-N |
| Canonical SMILES | COC1=CC=CC=C1C2=NN=C(O2)C3CCN(C3)CC4=CC=C(C=C4)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
Benzoic acid, 4-[[(3S)-3-[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-1-pyrrolidinyl]methyl]-; NAT31-459568 |