Systematic / IUPAC Name: 2-[(1S,4S,5S)-4-(Benzenesulfonamidomethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-(2-methoxyethyl)acetamide
ID: Reference10409
Other Names: NAT28-404238
Formula: C22H34N2O4S
2-[(1S,4S,5S)-5-Isopropyl-2-methyl-4-{[(phenylsulfonyl)amino]methyl}-2-cyclohexen-1-yl]-N-(2-methoxyethyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 5570 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/23/2021 10:46:29 AM |
| InChI | InChI=1S/C22H34N2O4S/c1-16(2)21-13-18(14-22(25)23-10-11-28-4)17(3)12-19(21)15-24-29(26,27)20-8-6-5-7-9-20/h5-9,12,16,18-19,21,24H,10-11,13-15H2,1-4H3,(H,23,25)/t18-,19-,21-/m0/s1 |
| InChI Key | PFBHYNOJPSEPNY-ZJOUEHCJSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NCCOC)C(C)C)CNS(=O)(=O)C2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names | NAT28-404238 |