Systematic / IUPAC Name: N-[[(1S,4S,6S)-4-[2-(Cyclopentylamino)-2-oxoethyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]-2-methoxybenzamide
ID: Reference10429
Other Names:
Benzamide, N-[[(1S,4S,6S)-4-[2-(cyclopentylamino)-2-oxoethyl]-3-methyl-6-(1-methylethyl)-2-cyclohexen-1-yl]methyl]-2-methoxy-;
NAT28-403281
Formula: C26H38N2O3
N-({(1S,4S,6S)-4-[2-(Cyclopentylamino)-2-oxoethyl]-6-isopropyl-3-methyl-2-cyclohexen-1-yl}methyl)-2-methoxybenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3000 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/30/2021 8:26:48 AM |
| InChI | InChI=1S/C26H38N2O3/c1-17(2)23-14-19(15-25(29)28-21-9-5-6-10-21)18(3)13-20(23)16-27-26(30)22-11-7-8-12-24(22)31-4/h7-8,11-13,17,19-21,23H,5-6,9-10,14-16H2,1-4H3,(H,27,30)(H,28,29)/t19-,20-,23-/m0/s1 |
| InChI Key | RNBAUQXCTILPKY-JTAQYXEDSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NC2CCCC2)C(C)C)CNC(=O)C3=CC=CC=C3OC |
| CAS | |
| Splash | |
| Other Names |
Benzamide, N-[[(1S,4S,6S)-4-[2-(cyclopentylamino)-2-oxoethyl]-3-methyl-6-(1-methylethyl)-2-cyclohexen-1-yl]methyl]-2-methoxy-; NAT28-403281 |