Systematic / IUPAC Name: 4-[[(3S)-3-(5-Chloro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]methyl]benzoic acid
ID: Reference10470
Other Names: NAT31-456663
Formula: C19H17ClN2O3
4-{[(3S)-3-(5-Chloro-1,3-benzoxazol-2-yl)-1-pyrrolidinyl]methyl}benzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2177 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/21/2021 7:08:51 AM |
| InChI | InChI=1S/C19H17ClN2O3/c20-15-5-6-17-16(9-15)21-18(25-17)14-7-8-22(11-14)10-12-1-3-13(4-2-12)19(23)24/h1-6,9,14H,7-8,10-11H2,(H,23,24)/t14-/m0/s1 |
| InChI Key | IZNJXKXIOBQSHA-AWEZNQCLSA-N |
| Canonical SMILES | C1CN(CC1C2=NC3=C(O2)C=CC(=C3)Cl)CC4=CC=C(C=C4)C(=O)O |
| CAS | |
| Splash | |
| Other Names | NAT31-456663 |