Systematic / IUPAC Name: 1-[[(1S,4S,6S)-3-Methyl-4-(2-morpholin-4-yl-2-oxoethyl)-6-propan-2-ylcyclohex-2-en-1-yl]methyl]-3-phenylurea
ID: Reference10474
Other Names: NAT28-405285
Formula: C24H35N3O3
1-({(1S,4S,6S)-6-Isopropyl-3-methyl-4-[2-(4-morpholinyl)-2-oxoethyl]-2-cyclohexen-1-yl}methyl)-3-phenylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2747 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/21/2021 12:18:16 PM |
| InChI | InChI=1S/C24H35N3O3/c1-17(2)22-14-19(15-23(28)27-9-11-30-12-10-27)18(3)13-20(22)16-25-24(29)26-21-7-5-4-6-8-21/h4-8,13,17,19-20,22H,9-12,14-16H2,1-3H3,(H2,25,26,29)/t19-,20-,22-/m0/s1 |
| InChI Key | YABGGRNPJXBMFQ-ONTIZHBOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)N2CCOCC2)C(C)C)CNC(=O)NC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT28-405285 |