Systematic / IUPAC Name: 5-Amino-4-chloro-2-methyl-3(2H)-pyridazinone
ID: Reference1049
Other Names: 1-Methyl-4-amino-5-chloro-6-oxo-(1H)-pyridazine
Formula: C5H6ClN3O
Class: Pesticides/Herbicides
5-Amino-4-chloro-2-methylpyridazin-3-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 73 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/11/2014 1:10:26 PM |
| InChI | InChI=1S/C5H6ClN3O/c1-9-5(10)4(6)3(7)2-8-9/h2H,7H2,1H3 |
| InChI Key | XNSGCNYTNLWRKM-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=O)C(=C(C=N1)N)Cl |
| CAS | 17254807 |
| Splash | |
| Other Names | 1-Methyl-4-amino-5-chloro-6-oxo-(1H)-pyridazine |