Systematic / IUPAC Name: Methyl 1-[(3S,3aR,6S,6aR)-3-(furan-2-ylmethylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate
ID: Reference10505
Other Names:
L-Iditol, 1,4:3,6-dianhydro-2,5-dideoxy-2-[(2-furanylmethyl)amino]-5-[4-(methoxycarbonyl)-1H-1,2,3-triazol-1-yl]-;
NAT6-305816
Formula: C15H18N4O5
1,4:3,6-Dianhydro-2,5-dideoxy-2-[(2-furylmethyl)amino]-5-[4-(methoxycarbonyl)-1H-1,2,3-triazol-1-yl]-L-iditol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 434 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/28/2021 8:15:07 AM |
| InChI | InChI=1S/C15H18N4O5/c1-21-15(20)10-6-19(18-17-10)12-8-24-13-11(7-23-14(12)13)16-5-9-3-2-4-22-9/h2-4,6,11-14,16H,5,7-8H2,1H3/t11-,12-,13+,14+/m0/s1 |
| InChI Key | QDDRYVRJPLCYKV-IGQOVBAYSA-N |
| Canonical SMILES | COC(=O)C1=CN(N=N1)C2COC3C2OCC3NCC4=CC=CO4 |
| CAS | |
| Splash | |
| Other Names |
L-Iditol, 1,4:3,6-dianhydro-2,5-dideoxy-2-[(2-furanylmethyl)amino]-5-[4-(methoxycarbonyl)-1H-1,2,3-triazol-1-yl]-; NAT6-305816 |