Systematic / IUPAC Name: 1-[(3S,3aR,6S,6aR)-3-[[4-(Furan-2-yl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-(3,5-dimethoxyphenyl)urea
ID: Reference10538
Other Names: NAT6-320273
Formula: C23H25N5O6
1,4:3,6-Dianhydro-2,5-dideoxy-2-{[(3,5-dimethoxyphenyl)carbamoyl]amino}-5-{[4-(2-furyl)-2-pyrimidinyl]amino}-L-iditol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1314 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/11/2021 11:52:53 AM |
| InChI | InChI=1S/C23H25N5O6/c1-30-14-8-13(9-15(10-14)31-2)25-23(29)28-18-12-34-20-17(11-33-21(18)20)27-22-24-6-5-16(26-22)19-4-3-7-32-19/h3-10,17-18,20-21H,11-12H2,1-2H3,(H,24,26,27)(H2,25,28,29)/t17-,18-,20+,21+/m0/s1 |
| InChI Key | RDORFJMVMVSIQD-FMWKFLBASA-N |
| Canonical SMILES | COC1=CC(=CC(=C1)NC(=O)NC2COC3C2OCC3NC4=NC=CC(=N4)C5=CC=CO5)OC |
| CAS | |
| Splash | |
| Other Names | NAT6-320273 |