Systematic / IUPAC Name: (2S,3S,4R,5R)-5-[[(4-Fluorophenyl)methylamino]methyl]-4-[4-(4-fluorophenyl)piperazin-1-yl]-2-(hydroxymethyl)oxolan-3-ol
ID: Reference10562
Other Names:
D-Galactitol, 2,5-anhydro-4,6-dideoxy-6-[[(4-fluorophenyl)methyl]amino]-4-[4-(4-fluorophenyl)-1-piperazinyl]-;
NAT27-401440
Formula: C23H29F2N3O3
2,5-Anhydro-4,6-dideoxy-6-[(4-fluorobenzyl)amino]-4-[4-(4-fluorophenyl)-1-piperazinyl]-D-galactitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2955 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/18/2021 8:29:22 AM |
| InChI | InChI=1S/C23H29F2N3O3/c24-17-3-1-16(2-4-17)13-26-14-20-22(23(30)21(15-29)31-20)28-11-9-27(10-12-28)19-7-5-18(25)6-8-19/h1-8,20-23,26,29-30H,9-15H2/t20-,21+,22+,23-/m1/s1 |
| InChI Key | SNYPKWYYTPTELC-WZYRSQIMSA-N |
| Canonical SMILES | C1CN(CCN1C2C(OC(C2O)CO)CNCC3=CC=C(C=C3)F)C4=CC=C(C=C4)F |
| CAS | |
| Splash | |
| Other Names |
D-Galactitol, 2,5-anhydro-4,6-dideoxy-6-[[(4-fluorophenyl)methyl]amino]-4-[4-(4-fluorophenyl)-1-piperazinyl]-; NAT27-401440 |