Systematic / IUPAC Name: 1-Aminocyclohexanecarboxylic acid
ID: Reference106
Other Names:
Cyclohexanecarboxylic acid, 1-amino-;
α-Aminocyclohexanecarboxylic acid;
Homocycloleucine
Formula: C7H13NO2
1-Aminocyclohexanecarboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 180 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/18/2014 1:11:57 PM |
| InChI | InChI=1S/C7H13NO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5,8H2,(H,9,10) |
| InChI Key | WOXWUZCRWJWTRT-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)C1(N)CCCCC1 |
| CAS | 2756856 |
| Splash | |
| Other Names |
Cyclohexanecarboxylic acid, 1-amino-; α-Aminocyclohexanecarboxylic acid; Homocycloleucine |
| ChemIDPlus | 002756856 |
| ChEMBL | CHEMBL559934 |
| PubChem | 1366 |
| ChemSpider | 1325 |