Systematic / IUPAC Name: (6S)-6-Phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole
ID: Reference1064
Other Names:
Imidazo[2,1-b]thiazole, 2,3,5,6-tetrahydro-6-phenyl-, (S)-;
L-2,3,5,6-Tetrahyro-6-phenylimidazo[2,1-b]thiazole;
Imidazo[2,1-b]imiazole, 2,3,5,6-tetrahydro-6-phenyl-, (6S)-;
2,3,5,6-Tetrahydro-6-phenyl-imidazo[2,1-b]thiazole, (S)-;
Ketrax
; more
Formula: C11H12N2S
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs
Levamisole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 338 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2018 8:02:56 AM |
| InChI | InChI=1S/C11H12N2S/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10/h1-5,10H,6-8H2/t10-/m1/s1 |
| InChI Key | HLFSDGLLUJUHTE-SNVBAGLBSA-N |
| Canonical SMILES | C1CSC2=NC(CN21)C3=CC=CC=C3 |
| CAS | 14769734 |
| Splash | |
| Other Names |
Imidazo[2,1-b]thiazole, 2,3,5,6-tetrahydro-6-phenyl-, (S)-; L-2,3,5,6-Tetrahyro-6-phenylimidazo[2,1-b]thiazole; Imidazo[2,1-b]imiazole, 2,3,5,6-tetrahydro-6-phenyl-, (6S)-; 2,3,5,6-Tetrahydro-6-phenyl-imidazo[2,1-b]thiazole, (S)-; Ketrax; L-Tetramisole; Wormicid; Lepuron; Ergamisol; Vermisol 150; Levomysol; Levamisole base; (S)-(-)-Levamisole; L(-)-Levamisole |
| ChEMBL | CHEMBL1454 |
| HMDb | HMDB14986 |
| PubChem | 26879 |
| DrugBank | APRD01067 |
| ChemSpider | 25037 |
| ChEBI | CHEBI:6432 |
| ChemIDPlus | 014769734; 027863178; 063027929 |
| KEGG | C07070; D08114 |
| Wikipedia | Levamisole |
| Cayman | 21321 |