Systematic / IUPAC Name: [(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(3,5-dimethoxyphenyl)carbamate
ID: Reference10706
Other Names:
Carbamic acid, N-(3,5-dimethoxyphenyl)-, [(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl ester;
NAT13-337319
Formula: C19H28N2O4
[(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl (3,5-dimethoxyphenyl)carbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2477 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/5/2021 2:37:56 PM |
| InChI | InChI=1S/C19H28N2O4/c1-4-13-11-21-6-5-14(13)7-16(21)12-25-19(22)20-15-8-17(23-2)10-18(9-15)24-3/h8-10,13-14,16H,4-7,11-12H2,1-3H3,(H,20,22)/t13-,14-,16+/m0/s1 |
| InChI Key | NPIOHURCBBKDRT-OFQRWUPVSA-N |
| Canonical SMILES | CCC1CN2CCC1CC2COC(=O)NC3=CC(=CC(=C3)OC)OC |
| CAS | |
| Splash | |
| Other Names |
Carbamic acid, N-(3,5-dimethoxyphenyl)-, [(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl ester; NAT13-337319 |