Systematic / IUPAC Name: N-[4-[(R)-Hydroxy-[(3R)-4-(2-methylpropyl)-5-oxomorpholin-3-yl]methyl]phenyl]-3,3-dimethylbutanamide
ID: Reference10777
Other Names:
Butanamide, N-[4-[(R)-hydroxy[(3R)-4-(2-methylpropyl)-5-oxo-3-morpholinyl]methyl]phenyl]-3,3-dimethyl-;
NAT36-504732
Formula: C21H32N2O4
N-(4-{(R)-Hydroxy[(3R)-4-isobutyl-5-oxo-3-morpholinyl]methyl}phenyl)-3,3-dimethylbutanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2470 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/20/2021 8:06:33 AM |
| InChI | InChI=1S/C21H32N2O4/c1-14(2)11-23-17(12-27-13-19(23)25)20(26)15-6-8-16(9-7-15)22-18(24)10-21(3,4)5/h6-9,14,17,20,26H,10-13H2,1-5H3,(H,22,24)/t17-,20-/m1/s1 |
| InChI Key | OVNVFLONAWZGPF-YLJYHZDGSA-N |
| Canonical SMILES | CC(C)CN1C(COCC1=O)C(C2=CC=C(C=C2)NC(=O)CC(C)(C)C)O |
| CAS | |
| Splash | |
| Other Names |
Butanamide, N-[4-[(R)-hydroxy[(3R)-4-(2-methylpropyl)-5-oxo-3-morpholinyl]methyl]phenyl]-3,3-dimethyl-; NAT36-504732 |