Systematic / IUPAC Name: N-[4-[(R)-Hydroxy-[(3R)-4-(2-methylpropyl)-5-oxomorpholin-3-yl]methyl]phenyl]thiophene-2-carboxamide
ID: Reference10780
Other Names:
2-Thiophenecarboxamide, N-[4-[(R)-hydroxy[(3R)-4-(2-methylpropyl)-5-oxo-3-morpholinyl]methyl]phenyl]-;
NAT36-504755
Formula: C20H24N2O4S
N-(4-{(R)-Hydroxy[(3R)-4-isobutyl-5-oxo-3-morpholinyl]methyl}phenyl)-2-thiophenecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2415 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/20/2021 8:11:31 AM |
| InChI | InChI=1S/C20H24N2O4S/c1-13(2)10-22-16(11-26-12-18(22)23)19(24)14-5-7-15(8-6-14)21-20(25)17-4-3-9-27-17/h3-9,13,16,19,24H,10-12H2,1-2H3,(H,21,25)/t16-,19-/m1/s1 |
| InChI Key | AORXRAMAFAXISF-VQIMIIECSA-N |
| Canonical SMILES | CC(C)CN1C(COCC1=O)C(C2=CC=C(C=C2)NC(=O)C3=CC=CS3)O |
| CAS | |
| Splash | |
| Other Names |
2-Thiophenecarboxamide, N-[4-[(R)-hydroxy[(3R)-4-(2-methylpropyl)-5-oxo-3-morpholinyl]methyl]phenyl]-; NAT36-504755 |