Systematic / IUPAC Name: N-[4-[(R)-Hydroxy-[(3R)-4-methyl-5-oxomorpholin-3-yl]methyl]phenyl]pyrazine-2-carboxamide
ID: Reference10792
Other Names:
2-Pyrazinecarboxamide, N-[4-[(R)-hydroxy[(3R)-4-methyl-5-oxo-3-morpholinyl]methyl]phenyl]-;
NAT36-509541
Formula: C17H18N4O4
N-(4-{(R)-Hydroxy[(3R)-4-methyl-5-oxo-3-morpholinyl]methyl}phenyl)-2-pyrazinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 995 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/27/2021 7:24:19 AM |
| InChI | InChI=1S/C17H18N4O4/c1-21-14(9-25-10-15(21)22)16(23)11-2-4-12(5-3-11)20-17(24)13-8-18-6-7-19-13/h2-8,14,16,23H,9-10H2,1H3,(H,20,24)/t14-,16-/m1/s1 |
| InChI Key | HWYNUPUYDSUIPC-GDBMZVCRSA-N |
| Canonical SMILES | CN1C(COCC1=O)C(C2=CC=C(C=C2)NC(=O)C3=NC=CN=C3)O |
| CAS | |
| Splash | |
| Other Names |
2-Pyrazinecarboxamide, N-[4-[(R)-hydroxy[(3R)-4-methyl-5-oxo-3-morpholinyl]methyl]phenyl]-; NAT36-509541 |