Systematic / IUPAC Name: N-[[(1S,4S,6S)-3-Methyl-4-(2-morpholin-4-yl-2-oxoethyl)-6-propan-2-ylcyclohex-2-en-1-yl]methyl]benzamide
ID: Reference10796
Other Names:
Benzamide, N-[[(1S,4S,6S)-3-methyl-6-(1-methylethyl)-4-[2-(4-morpholinyl)-2-oxoethyl]-2-cyclohexen-1-yl]methyl]-;
NAT28-405309
Formula: C24H34N2O3
N-({(1S,4S,6S)-6-Isopropyl-3-methyl-4-[2-(4-morpholinyl)-2-oxoethyl]-2-cyclohexen-1-yl}methyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2710 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/27/2021 7:30:01 AM |
| InChI | InChI=1S/C24H34N2O3/c1-17(2)22-14-20(15-23(27)26-9-11-29-12-10-26)18(3)13-21(22)16-25-24(28)19-7-5-4-6-8-19/h4-8,13,17,20-22H,9-12,14-16H2,1-3H3,(H,25,28)/t20-,21-,22-/m0/s1 |
| InChI Key | LQAPUOQAGIDLRE-FKBYEOEOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)N2CCOCC2)C(C)C)CNC(=O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
Benzamide, N-[[(1S,4S,6S)-3-methyl-6-(1-methylethyl)-4-[2-(4-morpholinyl)-2-oxoethyl]-2-cyclohexen-1-yl]methyl]-; NAT28-405309 |