Systematic / IUPAC Name: 2-[(2-Ethyl-6-methylphenyl)(1-methoxy-2-propanyl)amino]-2-oxoethanesulfonic acid
ID: Reference1081
Other Names:
Ethanesulfonic acid, 2-[(2-ethyl-6-methylphenyl)(2-methoxy-1-methylethyl)amino]-2-oxo-;
2-[2-Ethyl-N-(1-methoxypropan-2-yl)-6-methylanilino]-2-oxoethanesulfonic acid
Formula: C15H23NO5S
Class: Pesticides/Herbicides
Metolachlor ESA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 4 |
| No. of Spectra | 820 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 8/11/2014 4:05:08 PM |
| InChI | InChI=1S/C15H23NO5S/c1-5-13-8-6-7-11(2)15(13)16(12(3)9-21-4)14(17)10-22(18,19)20/h6-8,12H,5,9-10H2,1-4H3,(H,18,19,20) |
| InChI Key | CIGKZVUEZXGYSV-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=CC=CC(=C1N(C(C)COC)C(=O)CS(=O)(=O)O)C |
| CAS | 171118095 |
| Splash | |
| Other Names |
Ethanesulfonic acid, 2-[(2-ethyl-6-methylphenyl)(2-methoxy-1-methylethyl)amino]-2-oxo-; 2-[2-Ethyl-N-(1-methoxypropan-2-yl)-6-methylanilino]-2-oxoethanesulfonic acid |