Systematic / IUPAC Name: [(2-Ethyl-6-methylphenyl)(1-methoxy-2-propanyl)amino](oxo)acetic acid
ID: Reference1082
Other Names:
N-(2-Ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)oxalamic acid;
Metolachlor OA
Formula: C15H21NO4
Class: Pesticides/Herbicides
Metolachlor OXA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 2 |
| No. of Spectra | 121 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/14/2016 12:31:20 PM |
| InChI | InChI=1S/C15H21NO4/c1-5-12-8-6-7-10(2)13(12)16(11(3)9-20-4)14(17)15(18)19/h6-8,11H,5,9H2,1-4H3,(H,18,19) |
| InChI Key | LNOOSYCKMKZOJB-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=CC=CC(=C1N(C(C)COC)C(=O)C(=O)O)C |
| CAS | 152019733 |
| Splash | |
| Other Names |
N-(2-Ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)oxalamic acid; Metolachlor OA |