Systematic / IUPAC Name: N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(4-methoxyphenyl)cyclopentyl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide
ID: Reference10905
Other Names:
4-Isoxazolecarboxamide, N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-(4-methoxyphenyl)cyclopentyl]-5-methyl-3-phenyl-;
NAT38-538926
Formula: C23H24N2O5
N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(4-methoxyphenyl)cyclopentyl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3003 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/1/2021 7:55:32 AM |
| InChI | InChI=1S/C23H24N2O5/c1-13-19(20(25-30-13)15-6-4-3-5-7-15)23(28)24-21-17(12-18(26)22(21)27)14-8-10-16(29-2)11-9-14/h3-11,17-18,21-22,26-27H,12H2,1-2H3,(H,24,28)/t17-,18-,21-,22-/m1/s1 |
| InChI Key | CFZRPAUGHWDONT-MCEIDBOGSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)NC3C(CC(C3O)O)C4=CC=C(C=C4)OC |
| CAS | |
| Splash | |
| Other Names |
4-Isoxazolecarboxamide, N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-(4-methoxyphenyl)cyclopentyl]-5-methyl-3-phenyl-; NAT38-538926 |