Systematic / IUPAC Name: N-[(3S,5S)-1-Methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-3-yl]pyrazine-2-carboxamide
ID: Reference10907
Other Names:
2-Pyrazinecarboxamide, N-[(3S,5S)-1-methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-3-pyrrolidinyl]-;
NAT18-383035
Formula: C18H18N6O2
N-[(3S,5S)-1-Methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-3-pyrrolidinyl]-2-pyrazinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 630 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/1/2021 8:02:52 AM |
| InChI | InChI=1S/C18H18N6O2/c1-24-11-13(21-17(25)14-10-19-7-8-20-14)9-15(24)18-22-16(23-26-18)12-5-3-2-4-6-12/h2-8,10,13,15H,9,11H2,1H3,(H,21,25)/t13-,15-/m0/s1 |
| InChI Key | XORFHTCXJXCDAM-ZFWWWQNUSA-N |
| Canonical SMILES | CN1CC(CC1C2=NC(=NO2)C3=CC=CC=C3)NC(=O)C4=NC=CN=C4 |
| CAS | |
| Splash | |
| Other Names |
2-Pyrazinecarboxamide, N-[(3S,5S)-1-methyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-3-pyrrolidinyl]-; NAT18-383035 |