Systematic / IUPAC Name: N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(4-methoxyphenyl)cyclopentyl]-2-methoxybenzamide
ID: Reference10920
Other Names:
Benzamide, N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-(4-methoxyphenyl)cyclopentyl]-2-methoxy-;
NAT38-538908
Formula: C20H23NO5
N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(4-methoxyphenyl)cyclopentyl]-2-methoxybenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1459 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/8/2021 7:02:22 AM |
| InChI | InChI=1S/C20H23NO5/c1-25-13-9-7-12(8-10-13)15-11-16(22)19(23)18(15)21-20(24)14-5-3-4-6-17(14)26-2/h3-10,15-16,18-19,22-23H,11H2,1-2H3,(H,21,24)/t15-,16-,18-,19-/m1/s1 |
| InChI Key | LSFYFAWMONYUMM-PSBWJHGTSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C2CC(C(C2NC(=O)C3=CC=CC=C3OC)O)O |
| CAS | |
| Splash | |
| Other Names |
Benzamide, N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-(4-methoxyphenyl)cyclopentyl]-2-methoxy-; NAT38-538908 |