Systematic / IUPAC Name: N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(6-morpholin-4-ylpyridin-3-yl)cyclopentyl]-3-methoxybenzamide
ID: Reference10923
Other Names:
Benzamide, N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-[6-(4-morpholinyl)-3-pyridinyl]cyclopentyl]-3-methoxy-;
NAT38-539386
Formula: C22H27N3O5
N-{(1R,2S,3R,5R)-2,3-Dihydroxy-5-[6-(4-morpholinyl)-3-pyridinyl]cyclopentyl}-3-methoxybenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3055 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/8/2021 7:10:19 AM |
| InChI | InChI=1S/C22H27N3O5/c1-29-16-4-2-3-14(11-16)22(28)24-20-17(12-18(26)21(20)27)15-5-6-19(23-13-15)25-7-9-30-10-8-25/h2-6,11,13,17-18,20-21,26-27H,7-10,12H2,1H3,(H,24,28)/t17-,18-,20-,21-/m1/s1 |
| InChI Key | OETLXYRRJWWVFD-VURPSTOHSA-N |
| Canonical SMILES | COC1=CC=CC(=C1)C(=O)NC2C(CC(C2O)O)C3=CN=C(C=C3)N4CCOCC4 |
| CAS | |
| Splash | |
| Other Names |
Benzamide, N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-[6-(4-morpholinyl)-3-pyridinyl]cyclopentyl]-3-methoxy-; NAT38-539386 |