Systematic / IUPAC Name: N-[[(2R,4S,5S)-5-(Diethylaminomethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]-4-(trifluoromethyl)benzamide
ID: Reference10961
Other Names:
Benzamide, N-[[(2R,4S,5S)-5-[(diethylamino)methyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-4-(trifluoromethyl)-;
NAT13-339365
Formula: C21H30F3N3O
N-({(2R,4S,5S)-5-[(Diethylamino)methyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)-4-(trifluoromethyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 928 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/22/2021 6:19:22 AM |
| InChI | InChI=1S/C21H30F3N3O/c1-3-26(4-2)13-17-14-27-10-9-16(17)11-19(27)12-25-20(28)15-5-7-18(8-6-15)21(22,23)24/h5-8,16-17,19H,3-4,9-14H2,1-2H3,(H,25,28)/t16-,17-,19+/m0/s1 |
| InChI Key | AIJGDFIPPIWACF-JENIJYKNSA-N |
| Canonical SMILES | CCN(CC)CC1CN2CCC1CC2CNC(=O)C3=CC=C(C=C3)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
Benzamide, N-[[(2R,4S,5S)-5-[(diethylamino)methyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-4-(trifluoromethyl)-; NAT13-339365 |