Systematic / IUPAC Name: [(3S,3aR,6R,6aS)-3-[(4-Acetylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate
ID: Reference11045
Other Names:
D-Glucitol, 2-[[[(4-acetylphenyl)amino]carbonyl]amino]-1,4:3,6-dianhydro-2-deoxy-, 5-(cyclohexylcarbamate);
NAT6-269712
Formula: C22H29N3O6
2-{[(4-Acetylphenyl)carbamoyl]amino}-1,4:3,6-dianhydro-5-O-(cyclohexylcarbamoyl)-2-deoxy-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1146 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/19/2021 12:20:03 PM |
| InChI | InChI=1S/C22H29N3O6/c1-13(26)14-7-9-16(10-8-14)23-21(27)25-17-11-29-20-18(12-30-19(17)20)31-22(28)24-15-5-3-2-4-6-15/h7-10,15,17-20H,2-6,11-12H2,1H3,(H,24,28)(H2,23,25,27)/t17-,18+,19+,20+/m0/s1 |
| InChI Key | WRPUVJMMJWQOFS-MTQWCTHYSA-N |
| Canonical SMILES | CC(=O)C1=CC=C(C=C1)NC(=O)NC2COC3C2OCC3OC(=O)NC4CCCCC4 |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 2-[[[(4-acetylphenyl)amino]carbonyl]amino]-1,4:3,6-dianhydro-2-deoxy-, 5-(cyclohexylcarbamate); NAT6-269712 |