Systematic / IUPAC Name: Propyl [3-(dimethylamino)propyl]carbamate
ID: Reference1110
Other Names:
Plantacur;
Propamocarbe;
N-[3-(Dimethylamino)propyl]carbamic acid propyl ester;
Carbamic acid, [3-(dimethylamino)propyl], propyl ester
Formula: C9H20N2O2
Class: Pesticides/Herbicides
Propamocarb mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 577 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 10/14/2016 12:51:27 PM |
| InChI | InChI=1S/C9H20N2O2/c1-4-8-13-9(12)10-6-5-7-11(2)3/h4-8H2,1-3H3,(H,10,12) |
| InChI Key | WZZLDXDUQPOXNW-UHFFFAOYSA-N |
| Canonical SMILES | CCCOC(=O)NCCCN(C)C |
| CAS | 24579735 |
| Splash | |
| Other Names |
Plantacur; Propamocarbe; N-[3-(Dimethylamino)propyl]carbamic acid propyl ester; Carbamic acid, [3-(dimethylamino)propyl], propyl ester |
| ChemIDPlus | 024579735 |
| Wikipedia | Propamocarb |
| ChemSpider | 30114 |
| ChEMBL | CHEMBL1907431 |
| KEGG | C18885 |
| PubChem | 32490 |