Systematic / IUPAC Name: N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(4-methoxyphenyl)cyclopentyl]cyclopentanecarboxamide
ID: Reference11125
Other Names:
Cyclopentanecarboxamide, N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-(4-methoxyphenyl)cyclopentyl]-;
NAT38-538919
Formula: C18H25NO4
N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-(4-methoxyphenyl)cyclopentyl]cyclopentanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1927 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/17/2022 12:56:57 PM |
| InChI | InChI=1S/C18H25NO4/c1-23-13-8-6-11(7-9-13)14-10-15(20)17(21)16(14)19-18(22)12-4-2-3-5-12/h6-9,12,14-17,20-21H,2-5,10H2,1H3,(H,19,22)/t14-,15-,16-,17-/m1/s1 |
| InChI Key | NXBGSKLVWGRLJL-QBPKDAKJSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C2CC(C(C2NC(=O)C3CCCC3)O)O |
| CAS | |
| Splash | |
| Other Names |
Cyclopentanecarboxamide, N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-(4-methoxyphenyl)cyclopentyl]-; NAT38-538919 |