Systematic / IUPAC Name: (E)-N-{2-[({5-[(Dimethylamino)methyl]-2-furyl}methyl)sulfinyl]ethyl}-N'-methyl-2-nitro-1,1-ethenediamine
ID: Reference1114
Other Names:
Ranitidine S-oxide;
Ranitidine impurity C
Formula: C13H22N4O4S
Class: Therapeutics/Prescription Drugs
Ranitidine S-oxide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 53 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/12/2014 12:44:26 PM |
| InChI | InChI=1S/C13H22N4O4S/c1-14-13(9-17(18)19)15-6-7-22(20)10-12-5-4-11(21-12)8-16(2)3/h4-5,9,14-15H,6-8,10H2,1-3H3/b13-9+ |
| InChI Key | SKHXRNHSZTXSLP-UKTHLTGXSA-N |
| Canonical SMILES | [O-][N+](=O)\C=C(/NC)NCCS(=O)Cc1oc(cc1)CN(C)C |
| CAS | 73851704 |
| Splash | |
| Other Names |
Ranitidine S-oxide; Ranitidine impurity C |