Systematic / IUPAC Name:
ID: Reference11157
Other Names: AA102B
Formula: C15H11N3O3
N-(4-Nitrophenyl)-5-phenyl-1,3-oxazol-2-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 614 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/24/2022 1:33:40 PM |
| InChI | InChI=1S/C15H11N3O3/c19-18(20)13-8-6-12(7-9-13)17-15-16-10-14(21-15)11-4-2-1-3-5-11/h1-10H,(H,16,17) |
| InChI Key | WGTFGGOOYROCEY-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | AA102B |