Systematic / IUPAC Name: 4-(Dimethylamino)-3-methylphenyl N-methylcarbamate
ID: Reference1118
Other Names:
4-(Dimethylamino)-m-tolyl methylcarbamate;
3-Methyl-4-dimethylaminophenyl methylcarbamate;
Methylcarbamic acid 4-(dimethylamino)-m-tolyl ester;
Carbamic acid, methyl, 4-(dimethylamino)-m-tolyl ester;
Carbamic acid, methyl, 4-(dimethylamino)-3-methylphenyl ester
; more
Formula: C11H16N2O2
Class: Pesticides/Herbicides
Aminocarb mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1096 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/5/2014 11:02:29 AM |
| InChI | InChI=1S/C11H16N2O2/c1-8-7-9(15-11(14)12-2)5-6-10(8)13(3)4/h5-7H,1-4H3,(H,12,14) |
| InChI Key | IMIDOCRTMDIQIJ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=CC(=C1)OC(=O)NC)N(C)C |
| CAS | 2032599 |
| Splash | |
| Other Names |
4-(Dimethylamino)-m-tolyl methylcarbamate; 3-Methyl-4-dimethylaminophenyl methylcarbamate; Methylcarbamic acid 4-(dimethylamino)-m-tolyl ester; Carbamic acid, methyl, 4-(dimethylamino)-m-tolyl ester; Carbamic acid, methyl, 4-(dimethylamino)-3-methylphenyl ester; Aminocarbe; 4-(Dimethylamino)-3-methylphenol methyl carbamate; Matacil; Mitacil |
| KEGG | C11071 |
| ChEMBL | CHEMBL1079605 |
| ChemIDPlus | 002032599 |
| ChemSpider | 15416 |
| ChEBI | CHEBI:2653 |
| PubChem | 16247 |