Systematic / IUPAC Name: 5-Butyl-2-(ethylamino)-6-methyl-4-pyrimidinyl dimethylsulfamate
ID: Reference1121
Other Names:
Sulfamic acid, dimethyl, 5-butyl-2-(ethylamino)-6-methyl-4-pyrimidinyl ester;
Dimethylsulfamic acid 5-butyl-2-(ethylamino)-6-methyl-4-pyrimidinyl ester;
Nimrod
Formula: C13H24N4O3S
Class: Pesticides/Herbicides
Bupirimate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 6227 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/5/2014 11:00:34 AM |
| InChI | InChI=1S/C13H24N4O3S/c1-6-8-9-11-10(3)15-13(14-7-2)16-12(11)20-21(18,19)17(4)5/h6-9H2,1-5H3,(H,14,15,16) |
| InChI Key | DSKJPMWIHSOYEA-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC1=C(N=C(N=C1OS(=O)(=O)N(C)C)NCC)C |
| CAS | 41483436 |
| Splash | |
| Other Names |
Sulfamic acid, dimethyl, 5-butyl-2-(ethylamino)-6-methyl-4-pyrimidinyl ester; Dimethylsulfamic acid 5-butyl-2-(ethylamino)-6-methyl-4-pyrimidinyl ester; Nimrod |
| Wikipedia | Bupirimate |
| PubChem | 38884 |
| ChemIDPlus | 041483436 |
| ChemSpider | 35588 |
| KEGG | C18776 |