Systematic / IUPAC Name: N-[[(2R,3R,4S,5S)-3-[2-(Dimethylamino)ethyl-methylamino]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]-4-(trifluoromethyl)benzamide
ID: Reference11247
Other Names:
D-Galactitol, 2,5-anhydro-4,6-dideoxy-4-[[2-(dimethylamino)ethyl]methylamino]-6-[[4-(trifluoromethyl)benzoyl]amino]-;
NAT27-401203
Formula: C19H28F3N3O4
2,5-Anhydro-4,6-dideoxy-4-{[2-(dimethylamino)ethyl](methyl)amino}-6-{[4-(trifluoromethyl)benzoyl]amino}-D-galactitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 740 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/25/2022 11:27:22 AM |
| InChI | InChI=1S/C19H28F3N3O4/c1-24(2)8-9-25(3)16-14(29-15(11-26)17(16)27)10-23-18(28)12-4-6-13(7-5-12)19(20,21)22/h4-7,14-17,26-27H,8-11H2,1-3H3,(H,23,28)/t14-,15+,16+,17-/m1/s1 |
| InChI Key | CEDNMZYTSPNVRG-LTIDMASMSA-N |
| Canonical SMILES | CN(C)CCN(C)C1C(OC(C1O)CO)CNC(=O)C2=CC=C(C=C2)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
D-Galactitol, 2,5-anhydro-4,6-dideoxy-4-[[2-(dimethylamino)ethyl]methylamino]-6-[[4-(trifluoromethyl)benzoyl]amino]-; NAT27-401203 |