Systematic / IUPAC Name: 1-[[(2R,3S,4R)-4-[(4,4-Difluorocyclohexyl)amino]-3-hydroxyoxolan-2-yl]methyl]-3-phenylurea
ID: Reference11259
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-5-[[(phenylamino)carbonyl]amino]-;
NAT19-551913
Formula: C18H25F2N3O3
1,4-Anhydro-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-5-[(phenylcarbamoyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1393 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/4/2022 8:05:04 AM |
| InChI | InChI=1S/C18H25F2N3O3/c19-18(20)8-6-13(7-9-18)22-14-11-26-15(16(14)24)10-21-17(25)23-12-4-2-1-3-5-12/h1-5,13-16,22,24H,6-11H2,(H2,21,23,25)/t14-,15-,16+/m1/s1 |
| InChI Key | FMBCXEFOFCZZKY-OAGGEKHMSA-N |
| Canonical SMILES | C1CC(CCC1NC2COC(C2O)CNC(=O)NC3=CC=CC=C3)(F)F |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-5-[[(phenylamino)carbonyl]amino]-; NAT19-551913 |
| ChEMBL | CHEMBL3437153 |
| PubChem | 75536768 |
| ChemSpider | 29858692 |