Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-[(4,4-Difluorocyclohexyl)amino]-3-hydroxyoxolan-2-yl]methyl]cyclopentanecarboxamide
ID: Reference11275
Other Names:
D-Arabinitol, 1,4-anhydro-5-[(cyclopentylcarbonyl)amino]-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-;
NAT19-551213
Formula: C17H28F2N2O3
1,4-Anhydro-5-[(cyclopentylcarbonyl)amino]-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1703 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/11/2022 10:42:40 AM |
| InChI | InChI=1S/C17H28F2N2O3/c18-17(19)7-5-12(6-8-17)21-13-10-24-14(15(13)22)9-20-16(23)11-3-1-2-4-11/h11-15,21-22H,1-10H2,(H,20,23)/t13-,14-,15+/m1/s1 |
| InChI Key | RMFBUBMUUWOYRL-KFWWJZLASA-N |
| Canonical SMILES | C1CCC(C1)C(=O)NCC2C(C(CO2)NC3CCC(CC3)(F)F)O |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-5-[(cyclopentylcarbonyl)amino]-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-; NAT19-551213 |
| PubChem | 75536557 |
| ChemSpider | 29858444 |
| ChEMBL | CHEMBL3436915 |