Systematic / IUPAC Name: N-[Bis(methylsulfanyl)methylidene]-1H-indole-3-carboxamide
ID: Reference11297
Other Names:
Dimethyl (1H-indol-3-ylcarbonyl)carbonodithioimidate;
83_BB
Formula: C12H12N2OS2
Brassenin B mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 495 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/24/2022 11:56:09 AM |
| InChI | InChI=1S/C12H12N2OS2/c1-16-12(17-2)14-11(15)9-7-13-10-6-4-3-5-8(9)10/h3-7,13H,1-2H3 |
| InChI Key | JZBFMXQUNCMBQS-UHFFFAOYSA-N |
| Canonical SMILES | CSC(=NC(=O)C1=CNC2=CC=CC=C21)SC |
| CAS | |
| Splash | |
| Other Names |
Dimethyl (1H-indol-3-ylcarbonyl)carbonodithioimidate; 83_BB |