Systematic / IUPAC Name: N-[Bis(methylsulfanyl)methylidene]-2-(1-methoxyindol-3-yl)-2-oxoacetamide
ID: Reference11298
Other Names:
84_MeOGBB;
Dimethyl [(1-methoxy-1H-indol-3-yl)(oxo)acetyl]carbonodithioimidate
Formula: C14H14N2O3S2
MeO-Glyoxy-brasenin B mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 923 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/24/2022 12:57:10 PM |
| InChI | InChI=1S/C14H14N2O3S2/c1-19-16-8-10(9-6-4-5-7-11(9)16)12(17)13(18)15-14(20-2)21-3/h4-8H,1-3H3 |
| InChI Key | QTPMLGFWDYUNMP-UHFFFAOYSA-N |
| Canonical SMILES | CON1C=C(C2=CC=CC=C21)C(=O)C(=O)N=C(SC)SC |
| CAS | |
| Splash | |
| Other Names |
84_MeOGBB; Dimethyl [(1-methoxy-1H-indol-3-yl)(oxo)acetyl]carbonodithioimidate |