Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-[(3-Cyanophenyl)methylamino]-3-hydroxyoxolan-2-yl]methyl]cyclopentanecarboxamide
ID: Reference11329
Other Names:
D-Arabinitol, 1,4-anhydro-2-[[(3-cyanophenyl)methyl]amino]-5-[(cyclopentylcarbonyl)amino]-2,5-dideoxy-;
NAT19-551236
Formula: C19H25N3O3
1,4-Anhydro-2-[(3-cyanobenzyl)amino]-5-[(cyclopentylcarbonyl)amino]-2,5-dideoxy-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1805 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/1/2022 9:18:21 AM |
| InChI | InChI=1S/C19H25N3O3/c20-9-13-4-3-5-14(8-13)10-21-16-12-25-17(18(16)23)11-22-19(24)15-6-1-2-7-15/h3-5,8,15-18,21,23H,1-2,6-7,10-12H2,(H,22,24)/t16-,17-,18+/m1/s1 |
| InChI Key | DJIACLKOGJFVFJ-KURKYZTESA-N |
| Canonical SMILES | C1CCC(C1)C(=O)NCC2C(C(CO2)NCC3=CC(=CC=C3)C#N)O |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2-[[(3-cyanophenyl)methyl]amino]-5-[(cyclopentylcarbonyl)amino]-2,5-dideoxy-; NAT19-551236 |