Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-[(4,4-Difluorocyclohexyl)amino]-3-hydroxyoxolan-2-yl]methyl]cyclopropanecarboxamide
ID: Reference11340
Other Names:
D-Arabinitol, 1,4-anhydro-5-[(cyclopropylcarbonyl)amino]-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-;
NAT19-551113
Formula: C15H24F2N2O3
1,4-Anhydro-5-[(cyclopropylcarbonyl)amino]-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1240 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/8/2022 7:54:39 AM |
| InChI | InChI=1S/C15H24F2N2O3/c16-15(17)5-3-10(4-6-15)19-11-8-22-12(13(11)20)7-18-14(21)9-1-2-9/h9-13,19-20H,1-8H2,(H,18,21)/t11-,12-,13+/m1/s1 |
| InChI Key | PLDODJQHYFEKDE-UPJWGTAASA-N |
| Canonical SMILES | C1CC1C(=O)NCC2C(C(CO2)NC3CCC(CC3)(F)F)O |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-5-[(cyclopropylcarbonyl)amino]-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-; NAT19-551113 |
| ChemSpider | 29858420 |
| ChEMBL | CHEMBL3437297 |
| PubChem | 75536536 |