Systematic / IUPAC Name: 1-[[(2R,3S,4R)-3-Hydroxy-4-[(4-methoxyphenyl)methylamino]oxolan-2-yl]methyl]-3-propan-2-ylurea
ID: Reference11352
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[[(4-methoxyphenyl)methyl]amino]-5-[[[(1-methylethyl)amino]carbonyl]amino]-;
NAT19-551720
Formula: C17H27N3O4
1,4-Anhydro-2,5-dideoxy-5-[(isopropylcarbamoyl)amino]-2-[(4-methoxybenzyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 570 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/14/2022 6:53:57 AM |
| InChI | InChI=1S/C17H27N3O4/c1-11(2)20-17(22)19-9-15-16(21)14(10-24-15)18-8-12-4-6-13(23-3)7-5-12/h4-7,11,14-16,18,21H,8-10H2,1-3H3,(H2,19,20,22)/t14-,15-,16+/m1/s1 |
| InChI Key | RQFHBVUMSLKMRH-OAGGEKHMSA-N |
| Canonical SMILES | CC(C)NC(=O)NCC1C(C(CO1)NCC2=CC=C(C=C2)OC)O |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[[(4-methoxyphenyl)methyl]amino]-5-[[[(1-methylethyl)amino]carbonyl]amino]-; NAT19-551720 |
| ChEMBL | CHEMBL3437300 |
| ChemSpider | 29858649 |
| PubChem | 75536730 |