Systematic / IUPAC Name: (8aS)-7-(Benzenesulfonyl)-2-(pyridin-2-ylmethyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one
ID: Reference11366
Other Names: NAT50-554920
Formula: C18H20N4O3S
(8aS)-7-(Phenylsulfonyl)-2-(2-pyridinylmethyl)hexahydroimidazo[1,5-a]pyrazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1330 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/28/2022 11:42:27 AM |
| InChI | InChI=1S/C18H20N4O3S/c23-18-20(12-15-6-4-5-9-19-15)13-16-14-21(10-11-22(16)18)26(24,25)17-7-2-1-3-8-17/h1-9,16H,10-14H2/t16-/m0/s1 |
| InChI Key | IIFKXJHTTZKSTA-INIZCTEOSA-N |
| Canonical SMILES | C1CN2C(CN1S(=O)(=O)C3=CC=CC=C3)CN(C2=O)CC4=CC=CC=N4 |
| CAS | |
| Splash | |
| Other Names | NAT50-554920 |
| PubChem | 75536981 |
| ChEMBL | CHEMBL3437305 |
| ChemSpider | 29856076 |